Dioskouriite, CaCu4Cl6(OH)4∙4H2O: A New Mineral Description, Crystal Chemistry and Polytypism
Abstract
:1. Introduction
2. Occurrence and Mineral Associations
3. Methods
4. Results
4.1. General Appearance and Physical Properties
4.2. Optical Data
4.3. Raman Spectroscopy
4.4. Chemical Data
- dioskouriite-2O: Ca1.04(Cu4.02Mg0.01)Σ4.03[Cl5.96(OH)3.90O0.14]Σ10∙4H2O;
- dioskouriite-2M: (Ca1.00K0.03)Σ4.03(Cu4.01Mg0.08)Σ4.09[Cl5.99(OH)3.83O0.18]Σ10∙4H2O.
4.5. X-ray Crystallography and Crystal Structure
5. Discussion
5.1. Structure Description and Identification
5.2. Relations to Other Species
5.3. Structural Complexity and Relative Stability
Author Contributions
Funding
Institutional Review Board Statement
Informed Consent Statement
Data Availability Statement
Acknowledgments
Conflicts of Interest
References
- Vergasova, L.P.; Filatov, S.K. A study of volcanogenic exhalation mineralization. J. Volcanol. Seismol. 2016, 10, 71–85. [Google Scholar] [CrossRef]
- Pekov, I.V.; Zubkova, N.V.; Pushcharovsky, D.Y. Copper minerals from volcanic exhalations—a unique family of natural compounds: Crystal chemical review. Acta Crystallogr. 2018, B74, 502–518. [Google Scholar] [CrossRef]
- Vergasova, L.P.; Filatov, S.K. A new mineral, tolbachite, CuCl2. Dokl. Akad. Nauk SSSR 1983, 270, 415–417. (In Russian) [Google Scholar] [CrossRef]
- Vergasova, L.P.; Filatov, S.K. Chemical formula and crystal chemical characterization of melanothallite, Cu2OCl2. Zapiski RMO 1982, 124, 562–565. (In Russian) [Google Scholar]
- Vergasova, L.P.; Filatov, S.K.; Serafimova, E.K.; Semenova, T.F. Ponomarevite, K4Cu4OCl10, a new mineral from volcanic exhalations. Dokl. Akad. Nauk SSSR 1988, 300, 1197–1200. (In Russian) [Google Scholar]
- Pekov, I.V.; Zubkova, N.V.; Belakovskiy, D.I.; Lykova, I.S.; Yapaskurt, V.O.; Vigasina, M.F.; Sidorov, E.G.; Pushcharovsky, D.Y. Sanguite, KCuCl3, a new mineral from the Tolbachik volcano, Kamchatka, Russia. Can. Miner. 2015, 53, 633–641. [Google Scholar] [CrossRef]
- Pekov, I.V.; Agakhanov, A.A.; Zubkova, N.V.; Koshlyakova, N.V.; Shchipalkina, N.V.; Sandalov, F.D.; Yapaskurt, V.O.; Turchkova, A.G.; Sidorov, E.G. Oxidizing-type fumaroles of the Tolbachik Volcano, a mineralogical and geochemical unique. Russ. Geol. Geophys. 2020, 61, 675–688. [Google Scholar]
- Chukanov, N.V.; Murashko, M.N.; Zadov, A.E.; Bushmakin, A.F. Avdoninite, K2Cu5Cl8(OH)4·H2O, a new mineral from volcanic exhalations and from the zone of technogenesis at massive sulfide ore deposits. Zapiski RMO 2006, 148, 38–42. (In Russian) [Google Scholar]
- Pekov, I.V.; Krivovichev, S.V.; Chukanov, N.V.; Yapaskurt, V.O.; Sidorov, E.G. Avdoninite: New data, crystal structure and refined formula K2Cu5Cl8(OH)4·2H2O. Geol. Ore Dep. 2016, 58, 568–578. [Google Scholar] [CrossRef]
- Pekov, I.V.; Yapaskurt, V.O.; Britvin, S.N.; Vigasina, M.F.; Lykova, I.S.; Zubkova, N.V.; Krivovichev, S.V.; Sidorov, E.G. Romanorlovite, a new copper and potassium hydroxychloride from the Tolbachik volcano, Kamchatka, Russia. Geol. Ore Depos. 2017, 59, 601–608. [Google Scholar] [CrossRef]
- Pekov, I.V.; Zubkova, N.V.; Belakovskiy, D.I.; Yapaskurt, V.O.; Vigasina, M.F.; Lykova, I.S.; Sidorov, E.G.; Pushcharovsky, D.Y. Chrysothallite K6Cu6Tl3+Cl17(OH)4∙H2O, a new mineral species from the Tolbachik volcano, Kamchatka, Russia. Miner. Mag. 2015, 79, 365–376. [Google Scholar] [CrossRef]
- Pekov, I.V.; Zubkova, N.V.; Yapaskurt, V.O.; Belakovskiy, D.I.; Lykova, I.S.; Vigasina, M.F.; Ksenofontov, D.A.; Britvin, S.N.; Sidorov, E.G.; Khanin, D.A.; et al. Feodosiyite, Cu11Mg2Cl18(OH)8∙16H2O, a new mineral from the Tolbachik volcano, Kamchatka, Russia. N. Jb. Miner. Abh. 2018, 195, 27–39. [Google Scholar] [CrossRef] [PubMed]
- Crichton, W.; Müller, H. Centennialite, CaCu3(OH)6Cl2.nH2O, n = 0.7, a new kapellasite-like species, and a reassessment of calumetite. Mineral. Mag. 2016, 81, 1105–1124. [Google Scholar] [CrossRef]
- Miyawaki, R.; Hatert, F.; Pasero, M.; Mills, S.J. New minerals and nomenclature modifications approved in 2019. IMA Commission on New Minerals, Nomenclature and Classification (CNMNC), Newsletter 49. Mineral. Mag. 2019, 83, 479–483. [Google Scholar] [CrossRef]
- Schlüter, J.; Malcherek, T.; Pohl, D.; Schäfer, C. Vondechenite, a new hydrous calcium copper chloride hydroxide, from the Bellerberg, East-Eifel volcanic area, Germany. N. Jb. Mineral. Abh. 2018, 195, 79–86. [Google Scholar] [CrossRef]
- Nickel, E.H.; Grice, J.D. The IMA Commission on New Minerals and Mineral Names: Procedures and guidelines on mineral nomenclature. Can. Miner. 1998, 36, 913–926. [Google Scholar]
- Fedotov, S.A.; Markhinin, Y.K. (Eds.) The Great Tolbachik Fissure Eruption; Cambridge University Press: New York, NY, USA, 1983. [Google Scholar]
- Pekov, I.V.; Koshlyakova, N.N.; Zubkova, N.V.; Lykova, I.S.; Britvin, S.N.; Yapaskurt, V.O.; Agakhanov, A.A.; Shchipalkina, N.V.; Turchkova, A.G.; Sidorov, E.G. Fumarolic arsenates—A special type of arsenic mineralization. Eur. J. Mineral. 2018, 30, 305–322. [Google Scholar] [CrossRef]
- Britvin, S.N.; Dolivo-Dobrovolsky, D.V.; Krzhizhanovskaya, M.G. Software for processing the X-ray powder diffraction data obtained from the curved image plate detector of Rigaku RAXIS Rapid II diffractometer. Zap. Ross. Mineral. Obsh. 2017, 146, 104–107. (In Russian) [Google Scholar]
- Krivovichev, S.V.; Armbruster, T.; Yakovenchuk, V.N.; Pakhomovsky, Y.A.; Men’shikov, Y.P. Crystal structures of lamprophyllite-2M and lamprophyllite-2O from the Lovozero alkaline massif, Kola peninsula, Russia. Eur. J. Mineral. 2003, 15, 711–718. [Google Scholar] [CrossRef] [Green Version]
- Yakovenchuk, V.N.; Krivovichev, S.V.; Ivanyuk, G.Y.; Pakhomovsky, Y.A.; Selivanova, E.A.; Zhitova, E.A.; Kalashnikova, G.O.; Zolotarev, A.A.; Mikhailova, J.A.; Kadyrova, G.I. Kihlmanite-(Ce), Ce2TiO2[SiO4](HCO3)2(H2O), a new rare-earth mineral from the pegmatites of the Khibiny alkaline massif, Kola Peninsula, Russia. Mineral. Mag. 2014, 78, 483–496. [Google Scholar] [CrossRef]
- Agilent. CrysAlis PRO; Agilent Technologies UK Ltd.: Yarnton, UK, 2013. [Google Scholar]
- Brese, N.E.; O’Keeffe, M. Bond-valence parameters for solids. Acta Crystallogr. 1991, 47, 192–197. [Google Scholar] [CrossRef]
- Krivovichev, S.V.; Filatov, S.K.; Vergasova, L.P. The crystal structure of ilinskite, NaCu5O2(SeO3)2Cl3, and review of mixed-ligand CuOmCln coordination geometries in minerals and inorganic compounds. Miner. Petrol. 2013, 107, 235–242. [Google Scholar] [CrossRef]
- Jahn, H.A.; Teller, E. Stability of polyatomic molecules in degenerate electronic states. I. Orbital degeneracy. Proc. R. Soc. 1937, A161, 220–235. [Google Scholar]
- Hathaway, B.J. Copper. In Comprehensive Coordination Chemistry; Pergamon, G.W., Ed.; Oxford: Oxford, UK, 1987; Volume 5, pp. 533–774. [Google Scholar]
- Burns, P.C.; Hawthorne, F.C. Mixed-ligand Cu2+Φ6 octahedra in minerals: Observed stereochemistries and Hartree-Fock calculations. Can. Mineral. 1995, 33, 1177–1188. [Google Scholar]
- Kahlenberg, V. On the crystal structure of K2Cu5Cl8(OH)4·2(H2O). Z. Anorg. Allg. Chem. 2004, 630, 900–903. [Google Scholar] [CrossRef]
- Krivovichev, S.V.; Filatov, S.K.; Burns, P.C. The cuprite-like framework of OCu4 tetrahedra in the crystal structure of synthetic melanothallite, Cu2OCl2, and its negative thermal expansion. Can. Mineral. 2002, 40, 1185–1190. [Google Scholar] [CrossRef] [Green Version]
- Brownstein, S.; Han, N.F.; Gabe, E.J.; le Page, Y. A redetermination of the crystal structure of cupric chloride dihydrate. Z. Kristallogr. 1989, 189, 13–15. [Google Scholar] [CrossRef] [Green Version]
- Parise, J.B.; Hyde, B.G. The structure of atacamite and its relationships to spinel. Acta Crystallogr. 1986, B42, 1277–1280. [Google Scholar] [CrossRef]
- Malcherek, T.; Schlueter, J. Structures of the pseudo-trigonal polymorphs of Cu2(OH)3Cl. Acta Crystallogr. 2009, B65, 334–341. [Google Scholar] [CrossRef]
- Siidra, O.I.; Krivovichev, S.V.; Armbruster, T.; Filatov, S.K.; Pekov, I.V. The crystal structure of leningradite, PbCu3(VO4)2Cl2. Can. Mineral. 2007, 45, 445–449. [Google Scholar] [CrossRef]
- Siidra, O.I.; Krivovichev, S.V.; Turner, R.W.; Rumsey, M.S. Chloroxiphite Pb3CuO2(OH)2Cl2: Structure refinement and description of oxocentred OPb4 tetrahedra. Mineral. Mag. 2008, 72, 793–798. [Google Scholar] [CrossRef]
- Burdett, J.K.; Hoffmann, R.; Fay, R.C. Eight-Coordination. Inorg. Chem. 1978, 17, 2553–2568. [Google Scholar] [CrossRef]
- Merlino, S.; Perchiazzi, N.; Franco, D. Brochantite, Cu4SO4(OH)6: OD character, polytypism and crystal structures. Eur. J. Mineral. 2003, 15, 267–275. [Google Scholar] [CrossRef]
- Han, T.-H.; Singleton, J.; Schlueter, J.A. Barlowite: A spin-1212 antiferromagnet with a geometrically perfect kagome motif. Phys. Rev. Lett. 2014, 113, 227203. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Norman, M.R. Herbertsmithite and the search for the quantum spin liquid. Rev. Mod. Phys. 2016, 88, 041002. [Google Scholar] [CrossRef] [Green Version]
- Malcherek, T.; Mihailova, B.; Welch, M.D. Structural phase transitions of clinoatacamite and the dynamic Jahn-Teller effect. Phys. Chem. Miner. 2017, 44, 307–321. [Google Scholar] [CrossRef]
- Malcherek, T.; Welch, M.D.; Williams, P.A. The atacamite family of minerals—A testbed for quantum spin liquids. Acta Crystallogr. 2018, B74, 519–526. [Google Scholar] [CrossRef]
- Siidra, O.; Nazarchuk, E.; Agakhanov, A.; Polekhovsky, Y. Aleutite [Cu5O2](AsO4)(VO4)·(Cu0.5□0.5)Cl, a new complex salt-inclusion mineral with Cu2+ substructure derived from a Kagome-net. Mineral. Mag. 2019, 83, 847–853. [Google Scholar] [CrossRef]
- Smaha, R.W.; He, W.; Jiang, J.M. Materializing rival ground states in the barlowite family of kagome magnets: Quantum spin liquid, spin ordered, and valence bond crystal states. NPJ Quantum Mater. 2020, 5, 23. [Google Scholar] [CrossRef] [Green Version]
- Hiroi, Z.; Ishikawa, H.; Yoshida, H.; Yamaura, J.; Okamoto, Y. Orbital transitions and frustrated magnetism in the kagome-type copper mineral volborthite. Inorg. Chem. 2019, 58, 11949–11960. [Google Scholar] [CrossRef]
- Krivovichev, S.V.; Hawthorne, F.C.; Williams, P.A. Structural complexity and crystallization: The Ostwald sequence of phases in the Cu2(OH)3Cl system (botallackite–atacamite–clinoatacamite). Struct. Chem. 2017, 28, 153–159. [Google Scholar] [CrossRef]
- Hawthorne, F.C.; Cooper, M.A.; Grice, J.D.; Roberts, A.C.; Hubbard, N. Description and crystal structure of bobkingite, Cu2+5Cl2(OH)8(H2O)2, a new mineral from New Cliffe Hill Quarry, Stanton-under-Bardon, Leicestershire, UK. Mineral. Mag. 2002, 66, 301–311. [Google Scholar] [CrossRef]
- Krivovichev, S.V. Structural complexity of minerals: Information storage and processing in the mineral world. Mineral. Mag. 2013, 77, 275–326. [Google Scholar] [CrossRef]
- Krivovichev, S.V. Which inorganic structures are the most complex? Angew. Chem. Int. Ed. 2014, 53, 654–661. [Google Scholar] [CrossRef]
- Krivovichev, S.V.; Krivovichev, V.G.; Hazen, R.M. Structural and chemical complexity of minerals: Correlations and time evolution. Eur. J. Mineral. 2018, 30, 231–236. [Google Scholar] [CrossRef] [Green Version]
- Kolitsch, U.; Weil, M.; Kovrugin, V.; Krivovichev, S. Crystal chemistry of the variscite and metavariscite groups: Crystal structures of synthetic CrAsO4⋅2H2O, TlPO4⋅2H2O, MnSeO4⋅2H2O, CdSeO4⋅2H2O and natural bonacinaite, ScAsO4⋅2H2O. Mineral. Mag. 2020, 84, 568–583. [Google Scholar] [CrossRef]
Constituent | Dioskouriite-2O | Dioskouriite-2M | Probe Standard | ||||
---|---|---|---|---|---|---|---|
Wt% * | Range | SD | Wt% ** | Range | SD | ||
K2O | 0.03 | 0.00–0.12 | 0.03 | 0.21 | 0.00–0.39 | 0.19 | orthoclase |
MgO | 0.08 | 0.02–0.21 | 0.07 | 0.47 | 0.24–0.70 | 0.20 | diopside |
CaO | 8.99 | 8.56–9.36 | 0.32 | 8.60 | 8.18–8.97 | 0.39 | CaMoO4 |
CuO | 49.24 | 48.67–50.56 | 0.67 | 49.06 | 47.51–52.43 | 2.29 | CuFeS2 |
Cl | 32.53 | 31.10–33.17 | 0.81 | 32.66 | 30.03–33.97 | 1.78 | NaCl |
H2Ocalc *** | (16.48) | - | - | (16.38) | - | - | - |
−O=Cl | −7.35 | - | - | −7.38 | - | - | - |
Total | 100.00 | - | - | 100.00 | - | - | - |
Dioskouriite-2M | Dioskouriite-2O | ||||||||
---|---|---|---|---|---|---|---|---|---|
Iobs | dobs | Icalc * | dcalc ** | h k l | Iobs | dobs | Icalc * | dcalc ** | h k l |
100 | 10.29 | 100 | 10.214 | 002 | 100 | 10.34 | 100 | 10.280 | 002 |
3 | 9.26 | 1.5 | 9.197 | 011 | 2 | 9.28 | 1 | 9.260 | 011 |
3 | 7.30 | 3 | 7.252 | 012 | 3 | 7.32 | 2 | 7.301 | 012 |
22 | 5.960 | 2, 18 | 5.884, 5.881 | −111, 110 | 15 | 5.940 | 7 | 5.980 | 110 |
7 | 5.754 | 0.5 | 5.680 | 013 | 9 | 5.754 | 11 | 5.742 | 111 |
11 | 5.492 | 5, 6 | 5.452, 5.444 | −112, 111 | - | - | - | - | - |
16 | 5.170 | 5, 4 | 5.150, 5.107 | 020, 004 | 13 | 5.177 | 5, 5, 4 | 5.185, 5.169, 5.140 | 020, 112, 004 |
13 | 5.035 | 8 | 4.994 | 021 | 10 | 5.033 | 7 | 5.028 | 021 |
6 | 4.636 | 4 | 4.599 | 022 | 5 | 4.635 | 5 | 4.630 | 022 |
2 | 3.806 | 0.5 | 3.798 | 015 | - | - | - | - | - |
2 | 3.611 | 0.5, 1 | 3.626, 3.611 | 024, −115 | 2 | 3.601 | 1.5 | 3.603 | 201 |
1 | 3.555 | 0.5, 0.5 | 3.585, 3.582 | −202, 200 | - | - | - | - | - |
4 | 3.418 | 3 | 3.405 | 006 | 4 | 3.432 | 2 | 3.427 | 006 |
5 | 3.300 | 0.5, 2 | 3.312, 3.254 | −106, 032 | 4 | 3.282 | 1.5, 0.5 | 3.277, 3.272 | 032, 212 |
3 | 3.221 | 0.5, 3 | 3.213, 3.201 | −204, 025 | 4 | 3.226 | 0.5, 4 | 3.228, 3.222 | 203, 025 |
2 | 3.151 | 2, 0.5 | 3.153, 3.147 | −116, 115 | - | - | - | - | - |
6 | 3.087 | 1, 0.5, 3, 0.5 | 3.097, 3.067, 3.066, 3.062 | −131, −214, 033, 212 | 4 | 3.087 | 2, 2, 1 | 3.090, 3.087, 3.082 | 131, 033, 213 |
1.5 | 3.043 | 4 | 3.027 | 131 | - | - | - | - | - |
4 | 2.982 | 3, 3 | 2.942, 2.940 | −222, 220 | 4 | 2.986 | 4, 1.5 | 2.991, 2.973 | 132, 116 |
8 | 2.963 | 5, 2 | 2.904, 2.902 | −133, 132 | 5 | 2.956 | 6 | 2.959 | 221 |
2 | 2.878 | 1, 0.5, 0.5 | 2.883 | 106 | 3 | 2.876 | 0.5, 0.5 | 2.871, 2.869 | 222, 034 |
5 | 2.839 | 0.5, 0.5, 0.5 | 2.855, 2.852, 2.849 | −223, 221, 034 | 2 | 2.847 | 5 | 2.844 | 133 |
4 | 2.777 | 2.5 | 2.776 | 116 | - | - | - | - | - |
28 | 2.737 | 4, 4, 8, 7, 9, 9 | 2.743, 2.740, 2.726, 2.722, 2.721, 2.714 | −134, 133, −224, 222, −206, 204 | 21 | 2.735 | 15, 16 | 2.740, 2.734 | 223, 205 |
2 | 2.652 | 0.5 | 2.628 | 035 | 1.5 | 2.671 | 4 | 2.671 | 134 |
4 | 2.583 | 2, 1.5 | 2.571, 2.567 | −225, 223 | 3 | 2.581 | 3 | 2.585 | 224 |
3 | 2.512 | 0.5 | 2.540 | 027 | 6 | 2.524 | 3, 0.5 | 2.514, 2.513 | 042, 230 |
3 | 2.496 | 0.5, 3, 0.5, 0.5 | 2.497, 2.497, 2.480, 2.479 | −231, 042, −232, 230 | - | - | - | - | - |
8 | 2.417 | 0.5, 0.5, 0.5, 6, 6 | 2.418, 2.414, 2.408, 2.406, 2.401 | 036, 215, 043,−226, 224 | 6 | 2.419 | 12 | 2.418 | 225 |
2 | 2.354 | 1, 1 | 2.346, 2.343 | −234, 232 | 1 | 2.357 | 1 | 2.359 | 233 |
6 | 2.314 | 8 | 2.299 | 044 | 8 | 2.318 | 8 | 2.315 | 044 |
6 | 2.254 | 0.5, 0.5, 3 | 2.245, 2.242, 2.241 | −235, −144, −227 | 5 | 2.253 | 6 | 2.253 | 226 |
3 | 2.230 | 3, 0.5, 0.5 | 2.237, 2.227, 2.226 | 225, 118, −218 | - | - | - | - | - |
1 | 2.193 | 0.5, 1 | 2.221, 2.178 | 216, 045 | 1.5 | 2.197 | 1 | 2.193 | 045 |
6 | 2.096 | 0.5, 1, 1, 4, 4 | 2.093, 2.0912.084, 2.080 | 313, −242, 240,−228, 226 | 5 | 2.097 | 2, 8 | 2.104, 2.095 | 241, 227 |
3 | 2.064 | 3 | 2.054 | 046 | 3 | 2.067 | 3, 0.5 | 2.068, 2.061 | 046, 218 |
2 | 1.993 | 1, 1 | 1.995, 1.980 | −317, 150 | 1 | 1.986 | 1 | 1.986 | 151 |
2 | 1.953 | 1, 0.5, 1 | 1.962, 1.961, 1.961 | −152, −333, 151 | 1 | 1.953 | 1, 0.5, 0.5, 1, 0.5 | 1.959, 1.957, 1.956, 1.952, 1.949 | 152, 332, 244, 316, 228 |
- | - | - | - | - | 1 | 1.911 | 0.5, 1, 0.5 | 1.916, 1.914, 1.909 | 153, 333, 237 |
6 | 1.826 | 6, 0.5 | 1.820, 1.817 | −402, −336 | 5 | 1.822 | 6, 2, 6 | 1.830, 1.825, 1.815 | 400, 048, 229 |
5 | 1.814 | 2, 3, 3 | 1.813, 1.806, 1.802 | 048, −2.2.10, 228 | - | - | - | - | - |
2 | 1.796 | 0.5, 1 | 1.792, 1.791 | −404, 400 | 2 | 1.796 | 2, 1 | 1.802, 1.797 | 402, 238 |
2 | 1.720 | 0.5 | 1.716 | −422 | 2 | 1.719 | 1, 0.5, 1 | 1.722, 1.719, 1.717 | 061, 421, 247 |
2 | 1.696 | 0.5, 0.5, 0.5, 0.5, 1, 1 | 1.693, 1.693, 1.691, 1.689, 1.686, 1.685 | 062, −424, 420, 342, −3.1.10, −2.2.11 | 2 | 1.698 | 0.5, 2 | 1.702, 1.694 | 422, 2.2.10 |
1 | 1.604 | 1.5 | 1.600 | 0.4.10 | 2 | 1.615 | 0.5, 1.5 | 1.614, 1.611 | 406, 0.4.10 |
- | - | - | - | - | 3 | 1.588 | 1.5, 1, 0.5 | 1.591, 1.585, 1.580 | 425, 2.2.11, 350 |
- | - | - | - | - | 2 | 1.526 | 0.5, 1.5 | 1.535, 1.524 | 0.3.12, 263 |
2 | 1.476 | 1, 1 | 1.471, 1.470 | −444, 440 | 2 | 1.479 | 2 | 1.479 | 442 |
1 | 1.454 | 1, 1 | 1.452, 1.451 | −266, 264 | 1 | 1.462 | 2 | 1.461 | 265 |
1 | 1.428 | 1.5, 1.5 | 1.428, 1.426 | −446, 442 | 2 | 1.435 | 3 | 1.436 | 444 |
- | - | - | - | - | 1 | 1.422 | 1 | 1.422 | 266 |
1 | 1.371 | 1, 1 | 1.371, 1.370 | −268, 266 | 2 | 1.381 | 2 | 1.380 | 267 |
- | - | - | - | - | 1 | 1.369 | 1 | 1.370 | 446 |
1 | 1.272 | 0.5, 0.5, 0.5, 0.5 | 1.277, 1.277, 1.275, 1.269 | 082, 0.0.16, −178, 0.4.14 | 1 | 1.292 | 1, 1, 1 | 1.296, 1.292, 1.290 | 080, 448, 269 |
Polytype | Dioskouriite-2M | Dioskouriite-2O |
---|---|---|
Ideal formula | CaCu4(OH)4Cl6·4H2O | |
Ideal formula weight | 647.04 | |
Temperature, K | 293(2) | |
Radiation; λ, Å | MoKα; 0.71073 | |
Crystal system Space group; Z | Monoclinic P21/c; 4 | Orthorhombic P212121; 4 |
Unit cell dimensions, Å,° | a = 7.2792(8) b = 10.3000(7) β = 100.238(11) c = 20.758(2) | a = 7.3193(7) b = 10.3710(10) c = 20.560(3) |
V, Å3 | 1531.6(2) | 1560.6(3) |
μ, mm−1 | 6.881 | 6.752 |
F000 | 1256 | 1256 |
Crystal size, mm | 0.01 × 0.04 × 0.06 | 0.01 × 0.05 × 0.07 |
Diffractometer | Bruker APEX II DUO | Oxford Diffraction SuperNova |
θ range, ° | 1.98–28.28 | 3.41–28.28 |
Index ranges | −9 ≤ h ≤ 9 −13 ≤ k ≤ 13 −27 ≤ l ≤ 27 | −5 ≤ h ≤ 9 −13 ≤ k ≤ 9 −27 ≤ l ≤ 27 |
Reflections collected | 12590 | 9477 |
Independent reflections | 3846 (Rint = 0.1692) | 3866 (Rint = 0.1477) |
Independent reflections with I > 2σ(I) | 1805 | 1478 |
Data reduction | CrysAlisPro, version 1.171.36.32 [22] | |
Absorption correction | Multi-scan (empirical absorption correction using spherical harmonics, implemented in SCALE3 ABSPACK scaling algorithm) | |
Structure solution | Direct methods | |
Refinement method | Full-matrix least-squares on F2 | |
Refined parameters * | 187 | 201 |
Final R indices [I > 2σ(I)] | R1 = 0.1039, wR2 = 0.2574 | R1 = 0.0881, wR2 = 0.2023 |
Goodness of Fit (GoF) | 1.009 | 0.952 |
Largest difference peak and hole, e/Å3 | 4.61 and −2.72 | 1.53 and −1.25 |
Atom | x | y | z | Ueq | Q |
---|---|---|---|---|---|
Cu(1) | 0 | 0 | 0 | 0.0220(6) | 2 |
Cu(2) | 0 | ½ | 0 | 0.0251(7) | 2 |
Cu(3) | 0.7468(3) | 0.25540(14) | −0.00584(9) | 0.0235(5) | 4 |
Cu(4) | 0.8073(3) | 0.12383(17) | 0.12094(9) | 0.0318(6) | 4 |
Cu(5) | ½ | 0 | 0 | 0.0215(6) | 2 |
Cu(6) | ½ | ½ | 0 | 0.0240(7) | 2 |
Ca | 0.6720(6) | 0.4029(3) | −0.15357(17) | 0.0369(9) | 4 |
Cl(1) | 0.2829(7) | 0.3672(4) | 0.0669(2) | 0.0398(11) | 4 |
Cl(2) | 0.7835(7) | −0.1288(3) | 0.0794(2) | 0.0385(11) | 4 |
Cl(3) | 0.2828(6) | −0.0323(3) | 0.07185(18) | 0.0301(9) | 4 |
Cl(4) | 0.7867(7) | 0.4496(3) | 0.0775(2) | 0.0376(10) | 4 |
Cl(5) | 0.0684(8) | 0.1271(5) | 0.1965(2) | 0.0484(13) | 4 |
Cl(6) | 0.6082(7) | 0.1382(4) | 0.1902(2) | 0.0414(11) | 4 |
O(1) | 0.9088(17) | 0.3549(9) | −0.0542(5) | 0.030(3) | 4 |
O(2) | −0.0460(18) | 0.1531(9) | 0.0466(5) | 0.032(3) | 4 |
O(3) | 0.5390(16) | 0.3551(9) | −0.0547(5) | 0.027(3) | 4 |
O(4) | 0.5932(18) | 0.1532(8) | 0.0458(5) | 0.031(3) | 4 |
O(5) | 0.880(2) | 0.2442(12) | −0.1875(6) | 0.047(4) | 4 |
O(6) | 0.448(2) | 0.2326(13) | −0.1890(7) | 0.060(4) | 4 |
O(7) | 0.423(2) | 0.5363(13) | −0.2071(6) | 0.050(4) | 4 |
O(8) | 0.863(2) | 0.5471(13) | −0.2023(7) | 0.056(4) | 4 |
Peak | x | y | z | Height (e/Å3) |
---|---|---|---|---|
Cu(3') | 0.246(4) | 0.254(2) | −0.0036(12) | 1.89 |
Cu(4') | 0.311(5) | 0.126(3) | 0.1189(13) | 1.62 |
Site | x | y | z | Ueq | Q |
---|---|---|---|---|---|
Cu(1) | 0.1262(18) | 0.2504(13) | 0.4997(7) | 0.0205(18) | 4 |
Cu(2) | 0.6288(6) | 0.7491(3) | 0.5003(2) | 0.0199(8) | 4 |
Cu(3) | 0.3741(4) | 0.50486(19) | 0.49429(12) | 0.0184(5) | 4 |
Cu(4) | 0.3744(5) | 0.3734(2) | 0.62103(13) | 0.0276(6) | 4 |
Ca | 0.3805(11) | 0.6525(4) | 0.3472(2) | 0.0332(11) | 4 |
Cl(1) | 0.3727(9) | 0.2827(4) | 0.4284(3) | 0.0240(11) | 4 |
Cl(2) | 0.8828(10) | 0.6166(5) | 0.5678(3) | 0.0314(12) | 4 |
Cl(3) | 0.3772(9) | 0.1219(5) | 0.5792(3) | 0.0280(11) | 4 |
Cl(4) | 0.3754(11) | 0.7003(5) | 0.5775(3) | 0.0329(13) | 4 |
Cl(5) | 0.1371(10) | 0.3867(6) | 0.6906(3) | 0.0352(13) | 4 |
Cl(6) | 0.5985(11) | 0.3791(7) | 0.6955(3) | 0.0455(18) | 4 |
O(1) | 0.1959(18) | 0.4036(13) | 0.5480(8) | 0.022(4) | 4 |
O(2) | 0.6915(18) | 0.8965(14) | 0.5564(8) | 0.022(4) * | 4 |
O(3) | 0.0543(18) | 0.0998(12) | 0.4522(8) | 0.022(4) | 4 |
O(4) | 0.5619(16) | 0.6053(13) | 0.4452(7) | 0.017(3) * | 4 |
O(5) | 0.151(4) | 0.4940(17) | 0.3123(9) | 0.053(6) | 4 |
O(6) | 0.594(3) | 0.4842(18) | 0.3109(10) | 0.053(6) | 4 |
O(7) | 0.165(2) | 0.7942(15) | 0.2959(10) | 0.041(5) | 4 |
O(8) | 0.611(3) | 0.7887(17) | 0.2917(9) | 0.055(6) | 4 |
Peak | x | y | z | Height (e/Å3) |
---|---|---|---|---|
Cu(1′) | 0.609(18) | 0.250(12) | 0.507(7) | 3.48 |
Cu(2′) | 0.073(6) | 0.749(4) | 0.497(2) | 3.28 |
Cu(3′) | 0.854(2) | 0.5054(14) | 0.4952(8) | 4.47 |
Cu(4′) | 0.891(3) | 0.3744(16) | 0.6225(8) | 4.12 |
Cl(1′) | 0.851(10) | 0.280(6) | 0.426(3) | 1.50 |
Cl(2′) | 0.398(7) | 0.612(5) | 0.570(2) | 1.94 |
Cl(3′) | 0.906(7) | 0.113(6) | 0.578(3) | 1.65 |
Cl(4′) | 0.853(6) | 0.693(4) | 0.5728(18) | 2.58 |
Ca′ | 0.881(8) | 0.651(3) | 0.3429(17) | 2.38 |
Dioskouriite-2M | Dioskouriite-2O |
---|---|
Cu(1)−O(2) 1.910(10) × 2 −Cl(3) 2.341(4) × 2 −Cl(2) 2.808(5) × 2 Cu(2)−O(1) 1.917(9) × 2 −Cl(4) 2.480(5) × 2 −Cl(1) 2.651(5) × 2 Cu(3)−O(3) 1.956(11) −O(1) 1.966(11) −O(4) 1.983(11) −O(2) 1.996(12) −Cl(4) 2.627(4) −Cl(3) 2.664(4) Cu(4)−O(4) 2.022(12) −O(2) 2.049(12) −Cl(6) 2.220(5) −Cl(5) 2.239(5) −Cl(2) 2.737(4) Cu(5)−O(4) 1.904(9) × 2 −Cl(3) 2.382(4) × 2 −Cl(2) 2.744(5) × 2 Cu(6)−O(3) 1.926(10) × 2 −Cl(4) 2.453(5) × 2 −Cl(1) 2.660(5) × 2 Ca−O(8) 2.377(13) −O(7) 2.388(13) −O(5) 2.416(12) −O(6) 2.420(14) −O(3) 2.470(11) −O(1) 2.492(12) −Cl(1) 2.957(5) −Cl(6) 3.222(5) | Cu(1)−O(3) 1.915(17) −O(1) 1.942(18) −Cl(1) 2.348(17) −Cl(1) 2.397(17) −Cl(3) 2.777(14) −Cl(3) 2.797(14) Cu(2)−O(4) 1.936(14) −O(2) 1.970(15) −Cl(4) 2.467(9) −Cl(4) 2.493(9) −Cl(2) 2.673(8) −Cl(2) 2.697(8) Cu(3)−O(2) 1.980(15) −O(4) 1.998(14) −O(1) 2.007(14) −O(3) 2.032(14) −Cl(4) 2.652(6) −Cl(1) 2.672(5) Cu(4)−O(1) 2.015(15) −O(3) 2.019(16) −Cl(6) 2.245(8) −Cl(5) 2.255(7) −Cl(3) 2.747(6) Ca−O(7) 2.403(17) −O(6) 2.458(18) −O(5) 2.46(2) −O(4) 2.461(15) −O(2) 2.469(16) −O(8) 2.48(2) −Cl(2) 2.964(7) −Cl(5) 3.248(8) |
Site | Cu(1) | Cu(2) | Cu(3) | Cu(4) | Cu(5) | Cu(6) | Ca | Σ |
---|---|---|---|---|---|---|---|---|
Cl(1) | - | 0.17 x2↓ | - | - | - | 0.17 x2↓ | 0.20 | 0.54 |
Cl(2) | 0.11 x2↓ | - | - | 0.14 | 0.13 x2↓ | - | - | 0.38 |
Cl(3) | 0.40 x2↓ | - | 0.17 | - | 0.36 x2↓ | - | - | 0.93 |
Cl(4) | - | 0.27 x2↓ | 0.18 | - | - | 0.29 x2↓ | - | 0.74 |
Cl(5) | - | - | - | 0.52 | - | - | - | 0.52 |
Cl(6) | - | - | - | 0.55 | - | - | 0.10 | 0.65 |
O(1) = OH | - | 0.53 x2↓ | 0.46 | - | - | - | 0.24 | 1.23 |
O(2) = OH | 0.54 x2↓ | - | 0.42 | 0.37 | - | - | - | 1.33 |
O(3) = OH | - | - | 0.47 | - | - | 0.51 x2↓ | 0.26 | 1.24 |
O(4) = OH | - | - | 0.44 | 0.40 | 0.54 x2↓ | - | - | 1.38 |
O(5) = H2O | - | - | - | - | - | - | 0.30 | 0.30 |
O(6) = H2O | - | - | - | - | - | - | 0.29 | 0.29 |
O(7) = H2O | - | - | - | - | - | - | 0.32 | 0.32 |
O(8) = H2O | - | - | - | - | - | - | 0.33 | 0.33 |
Σ | 2.10 | 1.94 | 2.14 | 1.98 | 2.06 | 1.94 | 2.04 | - |
Site | Cu(1) | Cu(2) | Cu(3) | Cu(4) | Ca | Σ |
---|---|---|---|---|---|---|
Cl(1) | 0.39 0.34 | - | 0.16 | - | - | 0.89 |
Cl(2) | - | 0.16 0.15 | - | - | 0.20 | 0.51 |
Cl(3) | 0.120.12 | - | - | 0.13 | - | 0.37 |
Cl(4) | - | 0.280.26 | 0.17 | - | - | 0.71 |
Cl(5) | - | - | - | 0.50 | 0.09 | 0.59 |
Cl(6) | - | - | - | 0.52 | - | 0.52 |
O(1) = OH | 0.49 | - | 0.41 | 0.40 | - | 1.30 |
O(2) = OH | - | 0.46 | 0.44 | - | 0.26 | 1.16 |
O(3) = OH | 0.53 | - | 0.39 | 0.40 | - | 1.32 |
O(4) = OH | - | 0.50 | 0.42 | - | 0.26 | 1.18 |
O(5) = H2O | - | - | - | - | 0.26 | 0.26 |
O(6) = H2O | - | - | - | - | 0.27 | 0.27 |
O(7) = H2O | - | - | - | - | 0.31 | 0.31 |
O(8) = H2O | - | - | - | - | 0.25 | 0.25 |
Σ | 1.99 | 1.81 | 1.99 | 1.95 | 1.90 | - |
Publisher’s Note: MDPI stays neutral with regard to jurisdictional claims in published maps and institutional affiliations. |
© 2021 by the authors. Licensee MDPI, Basel, Switzerland. This article is an open access article distributed under the terms and conditions of the Creative Commons Attribution (CC BY) license (http://creativecommons.org/licenses/by/4.0/).
Share and Cite
Pekov, I.V.; Zubkova, N.V.; Zolotarev, A.A.; Yapaskurt, V.O.; Krivovichev, S.V.; Belakovskiy, D.I.; Lykova, I.; Vigasina, M.F.; Kasatkin, A.V.; Sidorov, E.G.; et al. Dioskouriite, CaCu4Cl6(OH)4∙4H2O: A New Mineral Description, Crystal Chemistry and Polytypism. Minerals 2021, 11, 90. https://doi.org/10.3390/min11010090
Pekov IV, Zubkova NV, Zolotarev AA, Yapaskurt VO, Krivovichev SV, Belakovskiy DI, Lykova I, Vigasina MF, Kasatkin AV, Sidorov EG, et al. Dioskouriite, CaCu4Cl6(OH)4∙4H2O: A New Mineral Description, Crystal Chemistry and Polytypism. Minerals. 2021; 11(1):90. https://doi.org/10.3390/min11010090
Chicago/Turabian StylePekov, Igor V., Natalia V. Zubkova, Andrey A. Zolotarev, Vasiliy O. Yapaskurt, Sergey V. Krivovichev, Dmitry I. Belakovskiy, Inna Lykova, Marina F. Vigasina, Anatoly V. Kasatkin, Evgeny G. Sidorov, and et al. 2021. "Dioskouriite, CaCu4Cl6(OH)4∙4H2O: A New Mineral Description, Crystal Chemistry and Polytypism" Minerals 11, no. 1: 90. https://doi.org/10.3390/min11010090